Home
Products
Diisobutyl phthalate
| Product Name | Diisobutyl phthalate |
| Price: | Inquiry |
| Catalog No.: | CN03655 |
| CAS No.: | 84-69-5 |
| Molecular Formula: | C16H22O4 |
| Molecular Weight: | 278.34 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The whole plants of Arum palaestinum Boiss. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(COC(=O)c1ccccc1C(=O)OCC(C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 295.3±8.0 °C at 760 mmHg |
| Flash Point | 153.9±7.9 °C |
| Exact Mass | 278.151794 |
| PSA | 52.60000 |
| LogP | 4.46 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |