Home
Products
Tectoquinone
| Product Name | Tectoquinone |
| Price: | Inquiry |
| Catalog No.: | CN05959 |
| CAS No.: | 84-54-8 |
| Molecular Formula: | C15H10O2 |
| Molecular Weight: | 222.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Anthraquinones |
| Physical Desc.: | Yellow cryst. |
| Source: | The roots of Morinda umbellata L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Cc1ccc2c(c1)C(=O)c1c(C2=O)cccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Tectoquinone (2-Methylanthraquinone) is a SARSCoV-2 main protease inhibitor against COVID-19. Tectoquinone exhibits strong mosquito larvicidal activity with the LC50 values of 3.3 and 5.4 μg/ml against A. aegypti and A. albopictus in 24 h, respectively[1][2]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 407.8±35.0 °C at 760 mmHg |
| Flash Point | 152.7±22.9 °C |
| Exact Mass | 222.068085 |
| PSA | 34.14000 |
| LogP | 3.84 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |