Home
Products
Syrosingopine
| Product Name | Syrosingopine |
| Price: | $293 / 10mg |
| Catalog No.: | CN02046 |
| CAS No.: | 84-36-6 |
| Molecular Formula: | C35H42N2O11 |
| Molecular Weight: | 666.71 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Rauvolfia yunnanensis Tsiang |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | CCOC(=O)Oc1c(OC)cc(cc1OC)C(=O)O[C@@H]1C[C@@H]2CN3CCc4c([C@H]3C[C@@H]2[C@@H]([C@H]1OC)C(=O)OC)[nH]c1c4ccc(c1)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Syrosingopine (Su 3118) is an antihypertensive agent. Syrosingopine can decrease brain dopamine levels[1][2]. |
| In Vitro | Syrosingopine sensitizes cancer cells to killing by metformin[1]. |
| Density | 1.35g/cm3 |
| Boiling Point | 795ºC at 760 mmHg |
| Flash Point | 434.6ºC |
| Exact Mass | 666.27900 |
| PSA | 144.08000 |
| LogP | 4.63570 |