Home
Products
2-Ethylhexyl trans-4-methoxycinnamate
| Product Name | 2-Ethylhexyl trans-4-methoxycinnamate |
| Price: | Inquiry |
| Catalog No.: | CN06967 |
| CAS No.: | 83834-59-7 |
| Molecular Formula: | C18H26O3 |
| Molecular Weight: | 290.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Oil |
| Source: | The barks of Cinnamomum cassia Presl |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCCCC(COC(=O)/C=C/c1ccc(cc1)OC)CC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 405.3±20.0 °C at 760 mmHg |
| Flash Point | 171.6±16.4 °C |
| Exact Mass | 290.188202 |
| PSA | 35.53000 |
| LogP | 5.66 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |