Home
Products
Ginsenoside Rd2 (Quinquenoside L10)
| Product Name | Ginsenoside Rd2 (Quinquenoside L10) |
| Price: | $453 / 10mg |
| Catalog No.: | CN07200 |
| CAS No.: | 83480-64-2 |
| Molecular Formula: | C47H80O17 |
| Molecular Weight: | 917.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Panax ginseng C. A. Mey. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@H]2CC[C@]3([C@H](C2(C)C)CC[C@@]2([C@@H]3C[C@@H](O)[C@H]3[C@@]2(C)CC[C@@H]3[C@@](O[C@@H]2O[C@H](CO[C@@H]3OC[C@@H]([C@@H]([C@H]3O)O)O)[C@H]([C@@H]([C@H]2O)O)O)(CCC=C(C)C)C)C)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ginsenoside Rd2 is a saponin found in Panax japonicus with anti-inflammatory actions[1]. |
| Density | 1.36±0.1 g/cm3 (20 ºC 760 Torr) |
| Storage condition | 2-8℃ |