Home
Products
Carpalasionin
| Product Name | Carpalasionin |
| Price: | Inquiry |
| Catalog No.: | CN08312 |
| CAS No.: | 83150-97-4 |
| Molecular Formula: | C22H28O8 |
| Molecular Weight: | 420.45 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The stems and leaves of Rabdosia lasiocarpa. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)OCC1(C)CCC2C3(C1C(O)OC3)C1C(O)CC3CC1(C(=O)O2)C(=O)C3=C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Carpalasionin is a natural product derived from Rabdosia serra. Rabdosia serra is an important component of Chinese herbal teas, traditionally used to treat hepatitis, jaundice, cholecystitis and colitis[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 655.9±55.0 °C at 760 mmHg |
| Flash Point | 229.9±25.0 °C |
| Exact Mass | 420.178406 |
| PSA | 119.36000 |
| LogP | -0.90 |
| Vapour Pressure | 0.0±4.5 mmHg at 25°C |