Home
Products
4-Aminoantipyrine
| Product Name | 4-Aminoantipyrine |
| Price: | Inquiry |
| Catalog No.: | CN00654 |
| CAS No.: | 83-07-8 |
| Molecular Formula: | C11H13N3O |
| Molecular Weight: | 203.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Nc1c(C)n(n(c1=O)c1ccccc1)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ampyrone is a reagent for glucose determination in the presence of peroxidase and phenol. |
| Target | COX |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 309.0±45.0 °C at 760 mmHg |
| Flash Point | 140.7±28.7 °C |
| Exact Mass | 203.105865 |
| PSA | 52.95000 |
| LogP | -0.40 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Storage condition | Store at RT. |