Home
Products
Pseudolaric Acid C
| Product Name | Pseudolaric Acid C |
| Price: | $86 / 10mg |
| Catalog No.: | CN08508 |
| CAS No.: | 82601-41-0 |
| Molecular Formula: | C21H26O7 |
| Molecular Weight: | 390.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The root barks of Pseudolarix amabilis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC(=O)C1=CCC23C(CC1)(O)C(CC2)C(OC3=O)(C)C=CC=C(C(=O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Pseudolaric C is a diterpenoid isolated from the root bark of Pseudolarix kaempferi Gorden, has antifungal activity[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 613.2±55.0 °C at 760 mmHg |
| Flash Point | 214.8±25.0 °C |
| Exact Mass | 390.167847 |
| PSA | 110.13000 |
| LogP | 1.92 |
| Vapour Pressure | 0.0±4.0 mmHg at 25°C |