Home
Products
5-Methyl-7-methoxyisoflavone
| Product Name | 5-Methyl-7-methoxyisoflavone |
| Price: | $23 / 20mg |
| Catalog No.: | CN04528 |
| CAS No.: | 82517-12-2 |
| Molecular Formula: | C17H14O3 |
| Molecular Weight: | 266.29 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Citrus aurantium L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(C)c2c(c1)occ(c2=O)c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 5-Methyl-7-methoxyisoflavone is a sensational, non-steroidal anabolic isoflavone. 5-Methyl-7-methoxyisoflavone shows potency increasing muscle mass and endurance[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 449.3±45.0 °C at 760 mmHg |
| Flash Point | 217.5±15.1 °C |
| Exact Mass | 266.094299 |
| PSA | 39.44000 |
| LogP | 3.95 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |