Home
Products
Demethoxydeacetoxypseudolaric acid B
| Product Name | Demethoxydeacetoxypseudolaric acid B |
| Price: | Inquiry |
| Catalog No.: | CN08756 |
| CAS No.: | 82508-36-9 |
| Molecular Formula: | C20H24O7 |
| Molecular Weight: | 376.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The root barks of Pseudolarix amabilis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C/C(=CC=C[C@@]1(C)OC(=O)[C@]23[C@]([C@H]1CC2)(O)CCC(=CC3)C(=O)O)/C(=O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Demethoxydeacetoxypseudolaric acid B is a metabolite of the glucoside of pseudolaric acid C2 (PC2)[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 528.8±50.0 °C at 760 mmHg |
| Flash Point | 228.0±30.2 °C |
| Exact Mass | 402.204254 |
| PSA | 121.13000 |
| LogP | 4.00 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |