Home
Products
Pseudolaric acid C2
| Product Name | Pseudolaric acid C2 |
| Price: | Inquiry |
| Catalog No.: | CN08231 |
| CAS No.: | 82508-35-8 |
| Molecular Formula: | C22H26O8 |
| Molecular Weight: | 418.44 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The root barks of Pseudolarix amabilis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)O[C@@]12CCC(=CC[C@@]32CC[C@H]1[C@@](C)(/C=C/C=C(/C(=O)O)C)OC3=O)C(=O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Pseudolaric Acid C2, a diterpenoid isolated from Pseudolarix kaempferi, is identified as the specific metabolite of Pseudolaric acid B in plasma, urine, bile and feces after both oral and intravenous administration to rats[1][2]. |