Home
Products
Pseudolaric acid A
| Product Name | Pseudolaric acid A |
| Price: | $146 / 20mg |
| Catalog No.: | CN08565 |
| CAS No.: | 82508-32-5 |
| Molecular Formula: | C22H28O6 |
| Molecular Weight: | 388.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The root barks of Pseudolarix amabilis. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC1=CC[C@@]23[C@](CC1)(OC(=O)C)[C@@H](CC2)[C@](OC3=O)(C)/C=C/C=C(/C(=O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Pseudolaric Acid A is a diterpene acid isolated from Pseudolarix kaempferi, has antifungal, cytotoxic and antifertile activities[1][2][3]. |
| Density | 1.23 |
| Boiling Point | 571.5±50.0 °C at 760 mmHg |
| Flash Point | 196.6±23.6 °C |
| Exact Mass | 388.188599 |
| PSA | 89.90000 |
| LogP | 3.49 |
| Vapour Pressure | 0.0±3.4 mmHg at 25°C |
| Storage condition | 2-8C |