Home
Products
Pseudolaric Acid B
| Product Name | Pseudolaric Acid B |
| Price: | $46 / 20mg |
| Catalog No.: | CN08910 |
| CAS No.: | 82508-31-4 |
| Molecular Formula: | C23H28O8 |
| Molecular Weight: | 432.46 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | White cryst. |
| Source: | The barks of Pseudolarix kaempferi Gordon. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC(=O)C1=CC[C@@]23[C@@](CC1)(OC(=O)C)[C@@H](CC2)[C@@](OC3=O)(C)/C=C/C=C(/C(=O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Pseudolaric Acid B is a diterpene isolated from the root of Pseudolarix kaempferi Gorden (pinaceae), has anti-cancer, antifungal, and antifertile activities, and shows immunosuppressive activity on T lymphocytes[1][2][3]. Pseudolaric Acid B inhibits hepatitis B virus (HBV) secretion through apoptosis and cell cycle arrest. Pseudolaric Acid B induces autophagy[4][5]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 613.8±55.0 °C at 760 mmHg |
| Flash Point | 208.8±25.0 °C |
| Exact Mass | 432.178406 |
| PSA | 116.20000 |
| LogP | 2.78 |
| Vapour Pressure | 0.0±3.8 mmHg at 25°C |
| Storage condition | 2-8°C |