Home
Products
Baicalin methyl ester
| Product Name | Baicalin methyl ester |
| Price: | $204 / 10mg |
| Catalog No.: | CN05073 |
| CAS No.: | 82475-03-4 |
| Molecular Formula: | C22H20O11 |
| Molecular Weight: | 460.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The roots of Scutellaria baicalensis Georgi |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | COC(=O)[C@H]1OC(Oc2cc3oc(cc(=O)c3c(c2O)O)c2ccccc2)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Baicalin methyl ester is a constituent of the roots of S. baicalmsis[1]. |
| Density | 1.631±0.06 g/cm3(Predicted) |
| Boiling Point | 754.5±60.0 °C(Predicted) |