Home
Products
Gomisin M2
| Product Name | Gomisin M2 |
| Price: | Inquiry |
| Catalog No.: | CN02909 |
| CAS No.: | 82425-45-4 |
| Molecular Formula: | C22H26O6 |
| Molecular Weight: | 386.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The fruits of Schizandra chinensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(OC)c(OC)cc2c1c1c(CC(C(C2)C)C)cc2c(c1O)OCO2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Gomisin M2 ((+)-Gomisin M2) is a lignan isolated from the fruits of Schisandra rubriflora with anti-HIV activity (EC50 of 2.4 μM). Gomisin M2 exhibits anti-cancer and anti-allergic activities and has the potential for Alzheimer’s disease research[1][2]. |
| Target | HIV:2.4 μM (EC50) |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 558.7±50.0 °C at 760 mmHg |
| Flash Point | 291.7±30.1 °C |
| Exact Mass | 386.172943 |
| PSA | 66.38000 |
| LogP | 5.34 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |