Home
Products
20-O-Acetylingenol-3-angelate
| Product Name | 20-O-Acetylingenol-3-angelate |
| Price: | Inquiry |
| Catalog No.: | CN08252 |
| CAS No.: | 82425-35-2 |
| Molecular Formula: | C27H36O7 |
| Molecular Weight: | 472.57 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The seeds of Euphorbia lathyris L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C/C=C(C(=O)O[C@H]1C(=C[C@]23[C@]1(O)[C@H](O)C(=C[C@H](C3=O)[C@H]1[C@@H](C[C@H]2C)C1(C)C)COC(=O)C)C)/C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 20-O-Acetylingenol-3-angelate is a natural compound. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 603.2±55.0 °C at 760 mmHg |
| Flash Point | 318.6±31.5 °C |
| LogP | 4.42 |
| Vapour Pressure | 0.0±3.9 mmHg at 25°C |
| Storage condition | 2-8℃ |