Home
Products
2,3,5,4'-Tetrahydroxyl diphenylethylene-2-O-glucoside
| Product Name | 2,3,5,4'-Tetrahydroxyl diphenylethylene-2-O-glucoside |
| Price: | $15 / 20mg |
| Catalog No.: | CN04075 |
| CAS No.: | 82373-94-2 |
| Molecular Formula: | C20H22O9 |
| Molecular Weight: | 406.39 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The roots of Polygonum multiflorum |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2c(/C=C/c3ccc(cc3)O)cc(cc2O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 2,3,4',5-tetrahydroxystilbene 2-O-D-glucoside isolats from the roots of Polygonum species, inhibits the formation of 5-HETE, HHT and thromboxane B2, although less strongly. [1] |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 715.0±60.0 °C at 760 mmHg |
| Flash Point | 386.2±32.9 °C |
| Exact Mass | 406.126373 |
| PSA | 160.07000 |
| LogP | 0.10 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Storage condition | ?20°C |