Home
Products
Humantenmine
| Product Name | Humantenmine |
| Price: | $263 / 10mg |
| Catalog No.: | CN01474 |
| CAS No.: | 82354-38-9 |
| Molecular Formula: | C19H22N2O3 |
| Molecular Weight: | 326.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Gelsemium elegans |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CON1c2ccccc2[C@@]2(C1=O)C[C@@H]1N=C([C@H]3C[C@@H]2OC[C@H]13)CC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Humantenmine, a newalkaloid isolated from Gelsemium elegan Banth in China, has the potential for pain and rheumatic arthritis treatment[1][2]. |
| In Vitro | Humantenmine (HMT) decreases the 14-day survival rate of the mice to 17% after they are intragastrically treated with HMT, along with hepatic injury and increasing alanine aminotransferase (ALT)/aspartate aminotransferase (AST) levels. CYP3A4/5 mediates the metabolism and detoxification of HMT[1][2]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 463.6±55.0 °C at 760 mmHg |
| Flash Point | 234.2±31.5 °C |
| Exact Mass | 326.163055 |
| PSA | 51.13000 |
| LogP | 3.68 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |