Home
Products
Daurichromenic acid
| Product Name | Daurichromenic acid |
| Price: | $439 / 10mg |
| Catalog No.: | CN03970 |
| CAS No.: | 82003-90-5 |
| Molecular Formula: | C23H30O4 |
| Molecular Weight: | 370.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The herbs of Rhododendron dauricum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCCC1(C)C=Cc2c(O1)cc(c(c2O)C(=O)O)C)CCC=C(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Daurichromenic acid is a chromene, which can be isolated from the leaves and twigs of Rhododendron dauricum. Daurichromenic acid has potent anti-HIV activity with an EC50 value of 0.00567 μg/mL[1]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 503.7±50.0 °C at 760 mmHg |
| Flash Point | 167.1±23.6 °C |
| Exact Mass | 370.214417 |
| PSA | 66.76000 |
| LogP | 9.20 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |