Home
Products
Ganoderic acid B
| Product Name | Ganoderic acid B |
| Price: | $219 / 10mg |
| Catalog No.: | CN07730 |
| CAS No.: | 81907-61-1 |
| Molecular Formula: | C30H44O7 |
| Molecular Weight: | 516.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The fruit body of Ganoderma lucidum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C(C[C@H](C(=O)O)C)C[C@H]([C@H]1CC(=O)[C@@]2([C@]1(C)CC(=O)C1=C2[C@@H](O)C[C@@H]2[C@]1(C)CC[C@@H](C2(C)C)O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ganoderic acid B is a triterpene isolated from a mushroom Ganoderma lucidum. Ganoderic acid B inhibits the activation of Epstein-Barr virus (EBV) antigens as telomerase inhibitor. Ganoderic acid B is a moderately active inhibitor against HIV-1 protease[1][2][3]. |
| Target | HIV-1 protease[3] |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 689.0±55.0 °C at 760 mmHg |
| Flash Point | 384.4±28.0 °C |
| Exact Mass | 516.308716 |
| PSA | 128.97000 |
| LogP | 2.33 |
| Vapour Pressure | 0.0±4.9 mmHg at 25°C |
| Storage condition | -20C |