Home
Products
Praeruptorin B
| Product Name | Praeruptorin B |
| Price: | $77 / 10mg |
| Catalog No.: | CN06285 |
| CAS No.: | 81740-07-0 |
| Molecular Formula: | C24H26O7 |
| Molecular Weight: | 426.46 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The roots of Peucedanum praeruptorum Dunn. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC=C(C(=O)OC1c2c(ccc3c2oc(=O)cc3)OC(C1OC(=O)C(=CC)C)(C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 524.8±50.0 °C at 760 mmHg |
| Flash Point | 225.5±30.2 °C |
| Exact Mass | 426.167847 |
| PSA | 92.04000 |
| LogP | 5.99 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Storage condition | 2~8℃ |