Home
Products
Rehmannioside C
| Product Name | Rehmannioside C |
| Price: | $315 / 5mg |
| Catalog No.: | CN03040 |
| CAS No.: | 81720-07-2 |
| Molecular Formula: | C21H34O14 |
| Molecular Weight: | 510.49 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | Powder |
| Source: | The roots of Rehmannia glutinosa |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OC2OC=CC3C2C(CC3O)OC2OC(CO)C(C(C2O)O)O)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Rehmannioside C is an iridoid glucoside isolated from Radix Rehmanniae Praeparata[1]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 803.2±65.0 °C at 760 mmHg |
| Flash Point | 439.5±34.3 °C |
| Exact Mass | 510.194855 |
| PSA | 228.22000 |
| LogP | -5.80 |
| Vapour Pressure | 0.0±6.4 mmHg at 25°C |
| Storage condition | 2-8℃ |