Home
Products
alpha-Dihydroartemisinin
| Product Name | alpha-Dihydroartemisinin |
| Price: | Inquiry |
| Catalog No.: | CN09344 |
| CAS No.: | 81496-81-3 |
| Molecular Formula: | C15H24O5 |
| Molecular Weight: | 284.34 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Cryst. |
| Source: | The herbs of Artemisia annua L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@@H]1O[C@@H]2O[C@@]3(C)CC[C@@H]4[C@]2([C@H]([C@H]1C)CC[C@H]4C)OO3 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 375.6±42.0 °C at 760 mmHg |
| Flash Point | 181.0±27.9 °C |
| Exact Mass | 284.162384 |
| PSA | 57.15000 |
| LogP | 2.60 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Storage condition | 2-8°C |