Home
Products
(-)-Pinoresinol
| Product Name | (-)-Pinoresinol |
| Price: | $497 / 5mg |
| Catalog No.: | CN02873 |
| CAS No.: | 81446-29-9 |
| Molecular Formula: | C20H22O6 |
| Molecular Weight: | 358.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The barks of Eucommia ulmoides |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(ccc1O)[C@@H]1OC[C@@H]2[C@H]1CO[C@H]2c1ccc(c(c1)OC)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (-)-Pinoresinol is a plant-derived tetrahydrofuran lignan that inhibits α-glucosidase and acts as a hypoglycemic agent. (-)-Pinoresinol has some anti-inflammatory effects and acts as a chemopreventive agent, inducing increased apoptosis and cell cycle G2/M arrest[1]. |
| Exact Mass | 358.14200 |
| PSA | 77.38000 |
| LogP | 3.19020 |