Home
Products
Sanggenone D
| Product Name | Sanggenone D |
| Price: | $351 / 20mg |
| Catalog No.: | CN05511 |
| CAS No.: | 81422-93-7 |
| Molecular Formula: | C40H36O12 |
| Molecular Weight: | 708.71 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The root barks of Morus alba L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCC12Oc3c(C2(O)Oc2c(C1=O)c(O)c(c(c2)O)C1C=C(C)CC(C1C(=O)c1ccc(cc1O)O)c1ccc(cc1O)O)ccc(c3)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Sanggenon D is a Diels-Alder-type adduct from Chinese crude drug root bark of Morus cathayana. Sanggenon D possesses antioxidant and inhibits Pancreatic lipase (PL) with the an IC50 of 0.77 μM[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 999.3±65.0 °C at 760 mmHg |
| Flash Point | 312.7±27.8 °C |
| Exact Mass | 708.220703 |
| PSA | 214.44000 |
| LogP | 7.94 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | 2-8℃ |