Home
Products
Phenoxodiol
| Product Name | Phenoxodiol |
| Price: | Inquiry |
| Catalog No.: | CN04222 |
| CAS No.: | 81267-65-4 |
| Molecular Formula: | C15H12O3 |
| Molecular Weight: | 240.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The seeds of Glycine max. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc(cc1)C1=Cc2c(OC1)cc(cc2)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Phenoxodiol, a synthetic analog of Genestein, activates the mitochondrial caspase system, inhibits XIAP (an apoptosis inhibitor), and sensitizes the cancer cells to Fas-mediated apoptosis. This agent also inhibits DNA topoisomerase II by stabilizing the cleavable complex. Phenoxodiol induces cell cycle arrest in the G1/S phase of the cell cycle and upregulates p21WAF1 via a p53 independent manner[1][2]. |
| Target | Caspase, DNA topoisomerase II[1][2]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 463.7±45.0 °C at 760 mmHg |
| Flash Point | 234.3±28.7 °C |
| Exact Mass | 240.078644 |
| PSA | 49.69000 |
| LogP | 4.35 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |