Home
Products
Rhodamine B
| Product Name | Rhodamine B |
| Price: | $31 / 20mg |
| Catalog No.: | CN00902 |
| CAS No.: | 81-88-9 |
| Molecular Formula: | C28H31ClN2O3 |
| Molecular Weight: | 479.01 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCN(c1ccc2c(c1)[o+]c1c(c2c2ccccc2C(=O)O)ccc(c1)N(CC)CC)CC.[Cl-] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Rhodamine B is a staining fluorescent dye, commonly used for dyeing textiles, paper, soap, leather, and drugs. |
| In Vitro | Rhodamine B induces a concentration-dependent reduction of root meristem cells of A. cepa. mitotic activity. Rhodamine B induces various nuclear aberrations in A. cepa. root cells. In the 100 and 200 ppm rhodamine B groups, the frequencies of NBUDs and BN surpass those of the positive control (MMS) group. Rhodamine B-induced changes of H2O2 (a) and MDA (b) level increase in a concentration-dependent manner in A. cepa. roots[1]. |
| Density | 0.79 g/mL at 20 °C |
| Flash Point | 12 °C |
| Exact Mass | 478.202332 |
| PSA | 56.69000 |
| LogP | 2.56500 |
| Storage condition | Store at RT. |