Home
Products
Purpurin
| Product Name | Purpurin |
| Price: | $46 / 20mg |
| Catalog No.: | CN05963 |
| CAS No.: | 81-54-9 |
| Molecular Formula: | C14H8O5 |
| Molecular Weight: | 256.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Anthraquinones |
| Physical Desc.: | Red cryst. |
| Source: | The herbs of Rubia cordifolia L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1c(O)cc(c2c1C(=O)c1ccccc1C2=O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Purpurin is a natural anthraquinone compound from Rubia tinctorum L.. Purpurin has antidepressant-like effects[1]. |
| In Vivo | Purpurin (Orally; 2, 6, 18 mg/kg for 3 weeks) exerts dose-dependently antidepressant-like effects on behavior and stress axis reactivity in adult male C57BL/6J mice (6-7 weeks old upon arrival)[1]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 525.1±45.0 °C at 760 mmHg |
| Flash Point | 285.4±25.2 °C |
| Exact Mass | 256.037170 |
| PSA | 94.83000 |
| LogP | 4.60 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Storage condition | 2-8C |