Home
Products
Taurocholic acid
| Product Name | Taurocholic acid |
| Price: | $62 / 20mg |
| Catalog No.: | CN02389 |
| CAS No.: | 81-24-3 |
| Molecular Formula: | C26H45NO7S |
| Molecular Weight: | 515.70 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | From snake bile. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@@H]1CC[C@]2([C@@H](C1)C[C@H]([C@@H]1[C@@H]2C[C@H](O)[C@]2([C@H]1CC[C@@H]2[C@@H](CCC(=O)NCCS(=O)(=O)O)C)C)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Taurocholic acid is a bile acid involved in the emulsification of fats. |
| Target | Human Endogenous Metabolite |
| In Vivo | The bile acid Taurocholic acid (TCA) exerts permeation enhancing effects in vivo[1]. |
| Density | 1.265g/cm3 |
| PSA | 152.54000 |
| LogP | 3.83980 |