Home
Products
20R-Ginsenoside Rg2
| Product Name | 20R-Ginsenoside Rg2 |
| Price: | Inquiry |
| Catalog No.: | CN07749 |
| CAS No.: | 80952-72-3 |
| Molecular Formula: | C42H72O13 |
| Molecular Weight: | 785.02 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Panax ginseng C. A. Mey. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OC2CC3(C)C(C4(C2C(C)(C)C(O)CC4)C)CC(C2C3(C)CCC2C(CCC=C(C)C)(O)C)O)C(C(C1O)O)OC1OC(C)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 20(R)-Ginsenoside Rg2, isolated from Ginseng stems and leaves, shows inhibitory effects on lung cancer NCI-H1650 cells. Anti-cancer activities[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 881.0±65.0 °C at 760 mmHg |
| Flash Point | 486.6±34.3 °C |
| Exact Mass | 784.497314 |
| PSA | 218.99000 |
| LogP | 6.78 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Storage condition | 2-8C |