Home
Products
(20R)-Ginsenoside Rh1
| Product Name | (20R)-Ginsenoside Rh1 |
| Price: | $62 / 20mg |
| Catalog No.: | CN07604 |
| CAS No.: | 80952-71-2 |
| Molecular Formula: | C36H62O9 |
| Molecular Weight: | 638.9 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Panax ginseng C. A. Mey. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@H]2C[C@]3(C)[C@@H]([C@@]4([C@@H]2C(C)(C)[C@@H](O)CC4)C)C[C@H]([C@H]2[C@@]3(C)CC[C@@H]2[C@@](CCC=C(C)C)(O)C)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (20R)-Ginsenoside Rh1, the R isomer of Ginsenoside Rh1 isolated from Panax Ginseng, inhibits the thrombin-induced conversion of fibrinogen to fibrin[1]. |
| Density | 1.23±0.1 g/cm3 |
| Boiling Point | 755.1±60.0 °C at 760 mmHg |
| Flash Point | 410.5±32.9 °C |
| Exact Mass | 638.439392 |
| PSA | 160.07000 |
| LogP | 3.74 |
| Vapour Pressure | 0.0±5.7 mmHg at 25°C |