Home
Products
Sec-O-Glucosylhamaudol
| Product Name | Sec-O-Glucosylhamaudol |
| Price: | $62 / 20mg |
| Catalog No.: | CN05495 |
| CAS No.: | 80681-44-3 |
| Molecular Formula: | C21H26O10 |
| Molecular Weight: | 438.43 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Ledebouriella seseloides. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@H]2Cc3c(OC2(C)C)cc2c(c3O)c(=O)cc(o2)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Sec-O-Glucosylhamaudol is a natural compound extracted from Peucedanum japonicum Thunb, decreases levels of μ-opioid receptor, with analgesic effect[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 677.5±55.0 °C at 760 mmHg |
| Flash Point | 237.2±25.0 °C |
| Exact Mass | 438.152588 |
| PSA | 159.05000 |
| LogP | 0.39 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Storage condition | 2-8C |