Home
Products
5-O-Methylvisamminol
| Product Name | 5-O-Methylvisamminol |
| Price: | $351 / 10mg |
| Catalog No.: | CN03320 |
| CAS No.: | 80681-42-1 |
| Molecular Formula: | C16H18O5 |
| Molecular Weight: | 290.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The roots of Saposhnikovia divaricata |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c2C[C@H](Oc2cc2c1c(=O)cc(o2)C)C(O)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 5-O-Methylvisamminol, a (furo) chromone identified in the extract of T. glauca, has a limited occurrence in the plant kingdom. 5-O-Methylvisamminol is useful in (chemical) phylogeny and is a possible excellent chemotaxonomic marker (family and/or subfamily level) for Apiaceae[1]. |
| Density | 1.281 g/cm3 |
| Boiling Point | 480.6ºC at 760 mmHg |
| Flash Point | 179.1ºC |
| Exact Mass | 290.11500 |
| PSA | 68.90000 |
| LogP | 2.18440 |