Home
Products
Fuziline
| Product Name | Fuziline |
| Price: | Inquiry |
| Catalog No.: | CN01077 |
| CAS No.: | 80665-72-1 |
| Molecular Formula: | C24H39NO7 |
| Molecular Weight: | 453.58 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Aconitum carmichaeli Debx. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC[C@]12CC[C@@H](C34[C@@H]2[C@@H](OC)C(C3N(C1)CC)[C@@]1([C@@H]2[C@H]4C[C@@H]([C@@H]2O)[C@H]([C@@H]1O)OC)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Fuziline is a alkaloid isolated from the lateral roots of Aconitum carmichaelii[1]. |
| In Vitro | Fuziline shows activity against pentobarbital sodiuminduced cardiomyocytes damage by obviously recovering beating rhythm and increasing the cell viability[1]. |
| In Vivo | Fuziline exhibits the mean half-life of 5.93 hours, 6.13 hours and 5.12 hours for 14 mg/kg, 2 4 mg/kg and 4 mg/kg, respectively, by oral administration in rat[2]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 596.9±50.0 °C at 760 mmHg |
| Flash Point | 314.8±30.1 °C |
| Exact Mass | 453.272644 |
| PSA | 111.85000 |
| LogP | -1.32 |
| Vapour Pressure | 0.0±3.8 mmHg at 25°C |
| Storage condition | 2-8C |