Home
Products
Schinifoline
| Product Name | Schinifoline |
| Price: | $263 / 10mg |
| Catalog No.: | CN01498 |
| CAS No.: | 80554-58-1 |
| Molecular Formula: | C17H23NO |
| Molecular Weight: | 257.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Capsicum annuum L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCCCCCCc1cc(=O)c2c(n1C)cccc2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Schinifoline, a 4-quinolinone derivative isolated from Zanthoxylum schinifolium Sieb, improves radiosensitizing effect, and effects cell cycle and apoptotic-inducing effects in cancer [1]. |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 362.6±42.0 °C at 760 mmHg |
| Flash Point | 124.0±17.3 °C |
| Exact Mass | 257.177979 |
| PSA | 22.00000 |
| LogP | 5.03 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |