Home
Products
Padmatin
| Product Name | Padmatin |
| Price: | $556 / 10mg |
| Catalog No.: | CN05249 |
| CAS No.: | 80453-44-7 |
| Molecular Formula: | C16H14O7 |
| Molecular Weight: | 318.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Blumea balsamifera |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2O[C@H](c3ccc(c(c3)O)O)[C@H](C(=O)c2c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Padmatin is a dihydroflavonol isolated from the heartwood of Prunus puddum[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 665.0±55.0 °C at 760 mmHg |
| Flash Point | 252.0±25.0 °C |
| Exact Mass | 318.073944 |
| PSA | 116.45000 |
| LogP | 2.00 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |