Home
Products
Notoginsenoside R2
| Product Name | Notoginsenoside R2 |
| Price: | $204 / 20mg |
| Catalog No.: | CN07667 |
| CAS No.: | 80418-25-3 |
| Molecular Formula: | C41H70O13 |
| Molecular Weight: | 771.0 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Panax notoginseng (Burk.)F.H.Chen |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@H]2C[C@]3(C)[C@@H]([C@@]4([C@@H]2C(C)(C)[C@@H](O)CC4)C)C[C@H]([C@H]2[C@@]3(C)CC[C@@H]2[C@](CCC=C(C)C)(O)C)O)[C@@H]([C@H]([C@@H]1O)O)O[C@@H]1OC[C@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Notoginsenoside R2 is a newly isolated notoginsenoside from Panax notoginseng, showed neuroprotective effects against 6-OHDA-induced oxidative stress and apoptosis. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 878.7±65.0 °C at 760 mmHg |
| Flash Point | 485.2±34.3 °C |
| Exact Mass | 770.481628 |
| PSA | 218.99000 |
| LogP | 6.45 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Storage condition | 2-8°C |