Home
Products
3-hydroxymorindone
| Product Name | 3-hydroxymorindone |
| Price: | $176 / 5mg |
| Catalog No.: | CN05946 |
| CAS No.: | 80368-74-7 |
| Molecular Formula: | C15H10O6 |
| Molecular Weight: | 286.24 g/mol |
| Purity: | >=95% |
| Type of Compound: | Anthraquinones |
| Physical Desc.: | Powder |
| Source: | The herbs of Morinda citrifolia |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc2c(c1O)C(=O)c1c(C2=O)c(O)c(c(c1)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3-Hydroxymorindone is an anthraquinone and a pigment[1][2]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 576.9±45.0 °C at 760 mmHg |
| Flash Point | 316.8±25.2 °C |
| Exact Mass | 286.047729 |
| LogP | 5.15 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |