Home
Products
2',3,5,6',7-Pentahydroxyflavanone
| Product Name | 2',3,5,6',7-Pentahydroxyflavanone |
| Price: | Inquiry |
| Catalog No.: | CN05250 |
| CAS No.: | 80366-15-0 |
| Molecular Formula: | C15H12O7 |
| Molecular Weight: | 304.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The roots of Scutellaria baicalensis Georgi |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1cc2OC(c3c(O)cccc3O)C(C(=O)c2c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 2′,3,5,6′,7-Pentahydroxyflavanone (compound 4) is a flavonoid compound isolated from Scutellaria baicalensis roots[1]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 713.4±60.0 °C at 760 mmHg |
| Flash Point | 273.8±26.4 °C |
| Exact Mass | 304.058289 |
| PSA | 127.45000 |
| LogP | 1.70 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |