Home
Products
Tinnevellin glucoside
| Product Name | Tinnevellin glucoside |
| Price: | Inquiry |
| Catalog No.: | CN03741 |
| CAS No.: | 80358-06-1 |
| Molecular Formula: | C20H24O9 |
| Molecular Weight: | 408.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The leaves of Cassia angustifolia |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc(OC)c3c(c2)cc(c(c3O)C(=O)C)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Tinnevellin glucoside, a naphthalene glycoside, isolated from Cassia senna leaves and pods[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 676.9±55.0 °C at 760 mmHg |
| Flash Point | 239.8±25.0 °C |
| Exact Mass | 408.142029 |
| PSA | 145.91000 |
| LogP | 0.91 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |