Home
Products
Artemisinic acid
| Product Name | Artemisinic acid |
| Price: | $82 / 20mg |
| Catalog No.: | CN09392 |
| CAS No.: | 80286-58-4 |
| Molecular Formula: | C15H22O2 |
| Molecular Weight: | 234.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Artemisia annua L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC1=C[C@H]2[C@@H](CC1)[C@H](C)CC[C@H]2C(=C)C(=O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Artemisinic acid (Qing Hao acid), an amorphane sesquiterpene isolated from Artemisia annua L., possesses a variety of pharmacological activity, such as antimalarial activity, anti-tumor activity, antipyretic effect, antibacterial activity, allelopathy effect and anti-adipogenesis effect[1]. |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 373.6±11.0 °C at 760 mmHg |
| Flash Point | 273.3±10.2 °C |
| Exact Mass | 234.161987 |
| PSA | 37.30000 |
| LogP | 5.11 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Storage condition | 2-8C |