Home
Products
Solanidine
| Product Name | Solanidine |
| Price: | Inquiry |
| Catalog No.: | CN00574 |
| CAS No.: | 80-78-4 |
| Molecular Formula: | C27H43NO |
| Molecular Weight: | 397.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Solanum nigrum L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@H]1CC[C@]2(C(=CC[C@@H]3[C@@H]2CC[C@]2([C@H]3C[C@H]3[C@@H]2[C@H](C)[C@@H]2N3C[C@H](CC2)C)C)C1)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Solanidine is a cholestane alkaloid isolated from several potato species including Solanum demissum, Solanum acaule, and Solanum tuberosum. Solanidine can inhibit proliferation and exhibit obvious antitumor effect[1]. |
| Density | 1.1g/cm3 |
| Boiling Point | 503.1ºC at 760 mmHg |
| Flash Point | 223.5ºC |
| Exact Mass | 397.33400 |
| PSA | 23.47000 |
| LogP | 5.59290 |