Home
Products
Forsythoside A
| Product Name | Forsythoside A |
| Price: | $46 / 20mg |
| Catalog No.: | CN07014 |
| CAS No.: | 79916-77-1 |
| Molecular Formula: | C29H36O15 |
| Molecular Weight: | 624.59 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | White powder |
| Source: | The fruits of Forsythia suspensa |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O=C(O[C@@H]1[C@@H](CO[C@@H]2O[C@@H](C)[C@@H]([C@H]([C@H]2O)O)O)O[C@H]([C@@H]([C@H]1O)O)OCCc1ccc(c(c1)O)O)/C=C/c1ccc(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Forsythiaside A, a phenylethanoside product isolated from air-dried fruits of Forsythia suspense, has anti-inflammatory and antioxidant effects[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 911.9±65.0 °C at 760 mmHg |
| Flash Point | 295.7±27.8 °C |
| Exact Mass | 624.205444 |
| PSA | 245.29000 |
| LogP | 2.12 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |