Home
Products
1,2,3,6-Tetragalloylglucose
| Product Name | 1,2,3,6-Tetragalloylglucose |
| Price: | $219 / 5mg |
| Catalog No.: | CN03860 |
| CAS No.: | 79886-50-3 |
| Molecular Formula: | C34H28O22 |
| Molecular Weight: | 788.57 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The peels of Punica granatum L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | Oc1cc(cc(c1O)O)C(=O)[C@@]([C@](C(=O)c1cc(O)c(c(c1)O)O)(C(=O)C(=O)c1cc(O)c(c(c1)O)O)O)([C@@H]([C@@H](C(C(=O)c1cc(O)c(c(c1)O)O)O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 1,2,3,6-Tetragalloylglucose is a potent UDP glucuronosyltransferase 1 family, polypeptide A1 (UGT1A1) inhibitor, with a Ki of 1.68 μM[1]. |
| Target | Ki: 1.68 μM (UGT1A1)[1]. |
| Exact Mass | 788.10700 |
| PSA | 377.42000 |
| LogP | 0.70460 |
| Storage condition | 2-8℃ |