Home
Products
4',6,7-Trimethoxyisoflavone
| Product Name | 4',6,7-Trimethoxyisoflavone |
| Price: | Inquiry |
| Catalog No.: | CN04310 |
| CAS No.: | 798-61-8 |
| Molecular Formula: | C18H16O5 |
| Molecular Weight: | 312.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Belamcanda chinensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc(cc1)c1coc2c(c1=O)cc(c(c2)OC)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.242 g/cm3 |
| Boiling Point | 487.5ºC at 760 mmHg |
| Exact Mass | 312.10000 |
| PSA | 57.90000 |
| LogP | 3.48580 |