Home
Products
Norbergenin
| Product Name | Norbergenin |
| Price: | Inquiry |
| Catalog No.: | CN03221 |
| CAS No.: | 79595-97-4 |
| Molecular Formula: | C13H14O9 |
| Molecular Weight: | 314.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The herbs of Bergenia purpurascens |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC[C@@H]1O[C@H]2[C@H]([C@@H]([C@H]1O)O)OC(=O)c1c2c(O)c(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Norbergenin, the O-demethyl derivative of bergenin, shows moderate antioxidant activity (IC50 13 μM in DPPH radical scavenging; 32 μM in superoxide anion scavenging)[1]. |
| Exact Mass | 314.06400 |
| PSA | 156.91000 |