Home
Products
Glaucocalyxin A
| Product Name | Glaucocalyxin A |
| Price: | $92 / 10mg |
| Catalog No.: | CN08728 |
| CAS No.: | 79498-31-0 |
| Molecular Formula: | C20H28O4 |
| Molecular Weight: | 332.43 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | White powder |
| Source: | The herbs of Rabdosia rubescens. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C=C1[C@@H]2CC[C@@H]3[C@](C1=O)([C@@H]2O)[C@H](O)C[C@H]1[C@@]3(C)CCC(=O)C1(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Glaucocalyxin A, an ent-kauranoid diterpene from Rabdosia japonica var., induces apoptosis in osteosarcoma by inhibiting nuclear translocation of Five-zinc finger Glis 1 (GLI1) via regulating PI3K/Akt signaling pathway. Glaucocalyxin A has antitumor effect[1]. |
| Target | PI3K Akt |
| In Vitro | Glaucocalyxin A induces apoptosis by mitochondrial apoptotic pathway through several steps including increasing the Bax/Bcl-2 ratio, triggering the intracellular reactive oxygen species (ROS) generation, reducing mitochondrial membrane potential (MMP), and inducing cleavage of caspase-9 and caspase-3[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 513.4±50.0 °C at 760 mmHg |
| Flash Point | 278.4±26.6 °C |
| Exact Mass | 332.198761 |
| PSA | 74.60000 |
| LogP | 0.88 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
| Storage condition | 2-8°C |