Home
Products
7-Hydroxyaristolochic acid A
| Product Name | 7-Hydroxyaristolochic acid A |
| Price: | $293 / 10mg |
| Catalog No.: | CN01216 |
| CAS No.: | 79185-75-4 |
| Molecular Formula: | C17H11NO8 |
| Molecular Weight: | 357.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Aristolochia debilis Sieb. et Zucc |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(O)ccc2c1cc([N+](=O)[O-])c1c2c2OCOc2cc1C(=O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 7-Hydroxyaristolochic acid A is an aristolochic acid analogue found in Aristolochia plants. Aristolochic acid can be used as an anti-inflammatory agent[1]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 663.7±55.0 °C at 760 mmHg |
| Flash Point | 355.2±31.5 °C |
| Exact Mass | 357.048462 |
| PSA | 131.04000 |
| LogP | 2.47 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |