Home
Products
Diammonium glycyrrhizinate
| Product Name | Diammonium glycyrrhizinate |
| Price: | $31 / 20mg |
| Catalog No.: | CN07437 |
| CAS No.: | 79165-06-3 |
| Molecular Formula: | C42H68N2O16 |
| Molecular Weight: | 857.00 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Glycyrrhiza glabra. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O[C@@H]1[C@@H](O[C@@H]2OC(C(=O)O)[C@H]([C@@H]([C@H]2O)O)O)[C@H](O[C@@H]([C@H]1O)C(=O)O)OC1CC[C@]2([C@H](C1(C)C)CCC1([C@@H]2C(=O)C=C2[C@@]1(C)CC[C@@]1([C@H]2C[C@](C)(CC1)C(=O)O)C)C)C.N.N |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Diammonium Glycyrrhizinate, isolated from the licorice root, is a widely used anti-inflammatory agent[1]. |
| Boiling Point | 1021.4ºC at 760 mmHg |
| Exact Mass | 856.456909 |
| PSA | 273.52000 |
| LogP | 2.89340 |