Home
Products
4-(2,6,6-Trimethyl-1-cyclohexenyl)-3-buten-2-one
| Product Name | 4-(2,6,6-Trimethyl-1-cyclohexenyl)-3-buten-2-one |
| Price: | Inquiry |
| Catalog No.: | CN06417 |
| CAS No.: | 79-77-6 |
| Molecular Formula: | C13H20O |
| Molecular Weight: | 192.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Oil |
| Source: | The volatile component of Camellia nitidissima. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)/C=C/C1=C(C)CCCC1(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 257.6±0.0 °C at 760 mmHg |
| Flash Point | 104.4±0.0 °C |
| Exact Mass | 192.151413 |
| PSA | 17.07000 |
| LogP | 3.86 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Storage condition | 2-8°C |